About propan-2-yl 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-tri(propan-2-yl)silyloxyacetate
propan-2-yl 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-tri(propan-2-yl)silyloxyacetate (PubChem CID 175607366) has the molecular formula C19H38O5Si
and a molecular weight of 374.59 g/mol. Its IUPAC name is propan-2-yl 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-tri(propan-2-yl)silyloxyacetate.
Molecular Properties
| Compound Name | propan-2-yl 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-tri(propan-2-yl)silyloxyacetate |
| PubChem CID | 175607366 |
| Molecular Formula | C19H38O5Si |
| Molecular Weight | 374.59 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | propan-2-yl 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-tri(propan-2-yl)silyloxyacetate |
| SMILES | CC(C)OC(=O)C(O[Si](C(C)C)(C(C)C)C(C)C)C1COC(C)(C)O1 |
| InChI | InChI=1S/C19H38O5Si/c1-12(2)22-18(20)17(16-11-21-19(9,10)23-16)24-25(13(3)4,14(5)6)15(7)8/h12-17H,11H2,1-10H3 |
| InChIKey | AUTNFHXAPLXDEQ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.59 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-tri(propan-2-yl)silyloxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-tri(propan-2-yl)silyloxyacetate?
The IUPAC name of propan-2-yl 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-tri(propan-2-yl)silyloxyacetate (CID 175607366) is propan-2-yl 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-tri(propan-2-yl)silyloxyacetate.
What is the SMILES notation for propan-2-yl 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-tri(propan-2-yl)silyloxyacetate?
The canonical SMILES for propan-2-yl 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-tri(propan-2-yl)silyloxyacetate is CC(C)OC(=O)C(O[Si](C(C)C)(C(C)C)C(C)C)C1COC(C)(C)O1.
What is the InChIKey of propan-2-yl 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-tri(propan-2-yl)silyloxyacetate?
The InChIKey is AUTNFHXAPLXDEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H38O5Si/c1-12(2)22-18(20)17(16-11-21-19(9,10)23-16)24-25(13(3)4,14(5)6)15(7)8/h12-17H,11H2,1-10H3.
What are the key properties of propan-2-yl 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-tri(propan-2-yl)silyloxyacetate?
propan-2-yl 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-tri(propan-2-yl)silyloxyacetate has a molecular weight of 374.59 g/mol, XLogP of 4.65, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-tri(propan-2-yl)silyloxyacetate is sourced from PubChem (CID 175607366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).