C21H23N4O2S+ — CID 175607456
6-(1H-indol-3-yl)-6-(4-methylphenyl)sulfonyliminohexane-2-diazonium (PubChem CID 175607456) has the molecular formula C21H23N4O2S+ and a molecular weight of 395.51 g/mol. Its IUPAC name is 6-(1H-indol-3-yl)-6-(4-methylphenyl)sulfonyliminohexane-2-diazonium.
| Compound Name | 6-(1H-indol-3-yl)-6-(4-methylphenyl)sulfonyliminohexane-2-diazonium |
|---|---|
| PubChem CID | 175607456 |
| Molecular Formula | C21H23N4O2S+ |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 6-(1H-indol-3-yl)-6-(4-methylphenyl)sulfonyliminohexane-2-diazonium |
| SMILES | Cc1ccc(S(=O)(=O)N=C(CCCC(C)[N+]#N)c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C21H23N4O2S/c1-15-10-12-17(13-11-15)28(26,27)25-21(9-5-6-16(2)24-22)19-14-23-20-8-4-3-7-18(19)20/h3-4,7-8,10-14,16,23H,5-6,9H2,1-2H3/q+1 |
| InChIKey | CNTGULSPJJKJIS-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 90.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|