C37H48N2O8 — CID 175607656
5-[4-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]-2,5-dimethylphenyl]-N-(2,3,4,5,6-pentahydroxyhexyl)pentanamide (PubChem CID 175607656) has the molecular formula C37H48N2O8 and a molecular weight of 648.80 g/mol. Its IUPAC name is 5-[4-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]-2,5-dimethylphenyl]-N-(2,3,4,5,6-pentahydroxyhexyl)pentanamide.
| Compound Name | 5-[4-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]-2,5-dimethylphenyl]-N-(2,3,4,5,6-pentahydroxyhexyl)pentanamide |
|---|---|
| PubChem CID | 175607656 |
| Molecular Formula | C37H48N2O8 |
| Molecular Weight | 648.80 g/mol |
| Exact Mass | 648.34 |
| IUPAC Name | 5-[4-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]-2,5-dimethylphenyl]-N-(2,3,4,5,6-pentahydroxyhexyl)pentanamide |
| SMILES | Cc1cc(COC2(c3cnccc3-c3ccccc3OC3CC3)CC2)c(C)cc1CCCCC(=O)NCC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C37H48N2O8/c1-23-18-26(24(2)17-25(23)7-3-6-10-34(43)39-20-31(41)35(44)36(45)32(42)21-40)22-46-37(14-15-37)30-19-38-16-13-28(30)29-8-4-5-9-33(29)47-27-11-12-27/h4-5,8-9,13,16-19,27,31-32,35-36,40-42,44-45H,3,6-7,10-12,14-15,20-22H2,1-2H3,(H,39,43) |
| InChIKey | CYPGOENZXHZTPP-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 161.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.80 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|