C35H43Cl2N3O9 — CID 175607674
1-[4-[2,5-dichloro-4-[[1-[4-[2-(oxetan-3-yloxy)phenyl]-3-pyridinyl]cyclopropyl]oxymethyl]phenyl]butyl]-3-(2,3,4,5,6-pentahydroxyhexyl)urea (PubChem CID 175607674) has the molecular formula C35H43Cl2N3O9 and a molecular weight of 720.65 g/mol. Its IUPAC name is 1-[4-[2,5-dichloro-4-[[1-[4-[2-(oxetan-3-yloxy)phenyl]-3-pyridinyl]cyclopropyl]oxymethyl]phenyl]butyl]-3-(2,3,4,5,6-pentahydroxyhexyl)urea.
| Compound Name | 1-[4-[2,5-dichloro-4-[[1-[4-[2-(oxetan-3-yloxy)phenyl]-3-pyridinyl]cyclopropyl]oxymethyl]phenyl]butyl]-3-(2,3,4,5,6-pentahydroxyhexyl)urea |
|---|---|
| PubChem CID | 175607674 |
| Molecular Formula | C35H43Cl2N3O9 |
| Molecular Weight | 720.65 g/mol |
| Exact Mass | 719.24 |
| IUPAC Name | 1-[4-[2,5-dichloro-4-[[1-[4-[2-(oxetan-3-yloxy)phenyl]-3-pyridinyl]cyclopropyl]oxymethyl]phenyl]butyl]-3-(2,3,4,5,6-pentahydroxyhexyl)urea |
| SMILES | O=C(NCCCCc1cc(Cl)c(COC2(c3cnccc3-c3ccccc3OC3COC3)CC2)cc1Cl)NCC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C35H43Cl2N3O9/c36-27-14-22(28(37)13-21(27)5-3-4-11-39-34(46)40-16-29(42)32(44)33(45)30(43)17-41)18-48-35(9-10-35)26-15-38-12-8-24(26)25-6-1-2-7-31(25)49-23-19-47-20-23/h1-2,6-8,12-15,23,29-30,32-33,41-45H,3-5,9-11,16-20H2,(H2,39,40,46) |
| InChIKey | FKFXYZOHODSYGA-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 182.86 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.65 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|