C41H57N3O8 — CID 175607824
5-[3-[[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]amino]methyl]-4-methylphenyl]-N-(3-methoxypropyl)-N-(2,3,4,5,6-pentahydroxyhexyl)hexanamide (PubChem CID 175607824) has the molecular formula C41H57N3O8 and a molecular weight of 719.92 g/mol. Its IUPAC name is 5-[3-[[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]amino]methyl]-4-methylphenyl]-N-(3-methoxypropyl)-N-(2,3,4,5,6-pentahydroxyhexyl)hexanamide.
| Compound Name | 5-[3-[[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]amino]methyl]-4-methylphenyl]-N-(3-methoxypropyl)-N-(2,3,4,5,6-pentahydroxyhexyl)hexanamide |
|---|---|
| PubChem CID | 175607824 |
| Molecular Formula | C41H57N3O8 |
| Molecular Weight | 719.92 g/mol |
| Exact Mass | 719.41 |
| IUPAC Name | 5-[3-[[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]amino]methyl]-4-methylphenyl]-N-(3-methoxypropyl)-N-(2,3,4,5,6-pentahydroxyhexyl)hexanamide |
| SMILES | COCCCN(CC(O)C(O)C(O)C(O)CO)C(=O)CCCC(C)c1ccc(C)c(CNC2(c3cnccc3-c3ccccc3OC3CC3)CC2)c1 |
| InChI | InChI=1S/C41H57N3O8/c1-27(8-6-11-38(48)44(20-7-21-51-3)25-35(46)39(49)40(50)36(47)26-45)29-13-12-28(2)30(22-29)23-43-41(17-18-41)34-24-42-19-16-32(34)33-9-4-5-10-37(33)52-31-14-15-31/h4-5,9-10,12-13,16,19,22,24,27,31,35-36,39-40,43,45-47,49-50H,6-8,11,14-15,17-18,20-21,23,25-26H2,1-3H3 |
| InChIKey | VDGSQFCBJLSKCX-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 164.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.92 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|