C39H49Cl2N3O9 — CID 175607830
5-[2,5-dichloro-4-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]phenyl]-N-[2-(dimethylamino)-2-oxoethyl]-N-(2,3,4,5,6-pentahydroxyhexyl)pentanamide (PubChem CID 175607830) has the molecular formula C39H49Cl2N3O9 and a molecular weight of 774.74 g/mol. Its IUPAC name is 5-[2,5-dichloro-4-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]phenyl]-N-[2-(dimethylamino)-2-oxoethyl]-N-(2,3,4,5,6-pentahydroxyhexyl)pentanamide.
| Compound Name | 5-[2,5-dichloro-4-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]phenyl]-N-[2-(dimethylamino)-2-oxoethyl]-N-(2,3,4,5,6-pentahydroxyhexyl)pentanamide |
|---|---|
| PubChem CID | 175607830 |
| Molecular Formula | C39H49Cl2N3O9 |
| Molecular Weight | 774.74 g/mol |
| Exact Mass | 773.28 |
| IUPAC Name | 5-[2,5-dichloro-4-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]phenyl]-N-[2-(dimethylamino)-2-oxoethyl]-N-(2,3,4,5,6-pentahydroxyhexyl)pentanamide |
| SMILES | CN(C)C(=O)CN(CC(O)C(O)C(O)C(O)CO)C(=O)CCCCc1cc(Cl)c(COC2(c3cnccc3-c3ccccc3OC3CC3)CC2)cc1Cl |
| InChI | InChI=1S/C39H49Cl2N3O9/c1-43(2)36(49)21-44(20-32(46)37(50)38(51)33(47)22-45)35(48)10-6-3-7-24-17-31(41)25(18-30(24)40)23-52-39(14-15-39)29-19-42-16-13-27(29)28-8-4-5-9-34(28)53-26-11-12-26/h4-5,8-9,13,16-19,26,32-33,37-38,45-47,50-51H,3,6-7,10-12,14-15,20-23H2,1-2H3 |
| InChIKey | ZPCYQIXVBKYJSE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 173.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 53 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.74 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|