C69H54N12O — CID 175609091
2,4,6-tris(21,23-dihydro-2H-porphyrin-1-ylmethyl)phenol (PubChem CID 175609091) has the molecular formula C69H54N12O and a molecular weight of 1067.27 g/mol. Its IUPAC name is 2,4,6-tris(21,23-dihydro-2H-porphyrin-1-ylmethyl)phenol.
| Compound Name | 2,4,6-tris(21,23-dihydro-2H-porphyrin-1-ylmethyl)phenol |
|---|---|
| PubChem CID | 175609091 |
| Molecular Formula | C69H54N12O |
| Molecular Weight | 1067.27 g/mol |
| Exact Mass | 1066.45 |
| IUPAC Name | 2,4,6-tris(21,23-dihydro-2H-porphyrin-1-ylmethyl)phenol |
| SMILES | Oc1c(CC23C=C4C=CC(=N4)C=c4ccc([nH]4)=CC4=NC(=CC(=CC2)N3)C=C4)cc(CC23C=C4C=CC(=N4)C=c4ccc([nH]4)=CC4=NC(=CC(=CC2)N3)C=C4)cc1CC12C=C3C=CC(=N3)C=c3ccc([nH]3)=CC3=NC(=CC(=CC1)N2)C=C3 |
| InChI | InChI=1S/C69H54N12O/c82-66-43(37-68-23-20-61(80-68)34-58-11-8-49(74-58)28-46-2-5-52(71-46)31-55-14-17-64(40-68)77-55)25-42(36-67-22-19-60(79-67)33-57-10-7-48(73-57)27-45-1-4-51(70-45)30-54-13-16-63(39-67)76-54)26-44(66)38-69-24-21-62(81-69)35-59-12-9-50(75-59)29-47-3-6-53(72-47)32-56-15-18-65(41-69)78-56/h1-21,25-35,39-41,70-72,79-82H,22-24,36-38H2 |
| InChIKey | DUJMXIIMPLSKTF-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 177.85 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 82 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1067.27 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |