C20H28N2O — CID 175609495
(6R)-6-ethyl-1-[2-(4-pyrrolidin-1-ylphenyl)ethylamino]cyclohexa-2,4-dien-1-ol (PubChem CID 175609495) has the molecular formula C20H28N2O and a molecular weight of 312.46 g/mol. Its IUPAC name is (6R)-6-ethyl-1-[2-(4-pyrrolidin-1-ylphenyl)ethylamino]cyclohexa-2,4-dien-1-ol.
| Compound Name | (6R)-6-ethyl-1-[2-(4-pyrrolidin-1-ylphenyl)ethylamino]cyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 175609495 |
| Molecular Formula | C20H28N2O |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | (6R)-6-ethyl-1-[2-(4-pyrrolidin-1-ylphenyl)ethylamino]cyclohexa-2,4-dien-1-ol |
| SMILES | CC[C@@H]1C=CC=CC1(O)NCCc1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C20H28N2O/c1-2-18-7-3-4-13-20(18,23)21-14-12-17-8-10-19(11-9-17)22-15-5-6-16-22/h3-4,7-11,13,18,21,23H,2,5-6,12,14-16H2,1H3/t18-,20?/m1/s1 |
| InChIKey | YDFOIHGTDNSRAL-QSVWIEALSA-N |
| XLogP | 3.26 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|