C16H15N3O — CID 175609678
cyclohepta-1,3,5-triene-1-carboxamide;pyrrolo[2,3-d]azepine (PubChem CID 175609678) has the molecular formula C16H15N3O and a molecular weight of 265.32 g/mol. Its IUPAC name is cyclohepta-1,3,5-triene-1-carboxamide;pyrrolo[2,3-d]azepine.
| Compound Name | cyclohepta-1,3,5-triene-1-carboxamide;pyrrolo[2,3-d]azepine |
|---|---|
| PubChem CID | 175609678 |
| Molecular Formula | C16H15N3O |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | cyclohepta-1,3,5-triene-1-carboxamide;pyrrolo[2,3-d]azepine |
| SMILES | NC(=O)C1=CC=CC=CC1.c1cc2ccnc-2ccn1 |
| InChI | InChI=1S/C8H6N2.C8H9NO/c1-4-9-5-3-8-7(1)2-6-10-8;9-8(10)7-5-3-1-2-4-6-7/h1-6H;1-5H,6H2,(H2,9,10) |
| InChIKey | LEMYATBVAVUJSV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |