About (1R)-1-(8-fluoro-3,4-dihydro-1H-isochromen-1-yl)-N-methylethanamine;pentanedioic acid
(1R)-1-(8-fluoro-3,4-dihydro-1H-isochromen-1-yl)-N-methylethanamine;pentanedioic acid (PubChem CID 175609770) has the molecular formula C17H24FNO5
and a molecular weight of 341.38 g/mol. Its IUPAC name is (1R)-1-(8-fluoro-3,4-dihydro-1H-isochromen-1-yl)-N-methylethanamine;pentanedioic acid.
Molecular Properties
| Compound Name | (1R)-1-(8-fluoro-3,4-dihydro-1H-isochromen-1-yl)-N-methylethanamine;pentanedioic acid |
| PubChem CID | 175609770 |
| Molecular Formula | C17H24FNO5 |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | (1R)-1-(8-fluoro-3,4-dihydro-1H-isochromen-1-yl)-N-methylethanamine;pentanedioic acid |
| SMILES | CN[C@H](C)C1OCCc2cccc(F)c21.O=C(O)CCCC(=O)O |
| InChI | InChI=1S/C12H16FNO.C5H8O4/c1-8(14-2)12-11-9(6-7-15-12)4-3-5-10(11)13;6-4(7)2-1-3-5(8)9/h3-5,8,12,14H,6-7H2,1-2H3;1-3H2,(H,6,7)(H,8,9)/t8-,12?;/m1./s1 |
| InChIKey | LVYHKZSTIMTVGE-CFKUEIMKSA-N |
| XLogP | 2.37 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1R)-1-(8-fluoro-3,4-dihydro-1H-isochromen-1-yl)-N-methylethanamine;pentanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-(8-fluoro-3,4-dihydro-1H-isochromen-1-yl)-N-methylethanamine;pentanedioic acid?
The IUPAC name of (1R)-1-(8-fluoro-3,4-dihydro-1H-isochromen-1-yl)-N-methylethanamine;pentanedioic acid (CID 175609770) is (1R)-1-(8-fluoro-3,4-dihydro-1H-isochromen-1-yl)-N-methylethanamine;pentanedioic acid.
What is the SMILES notation for (1R)-1-(8-fluoro-3,4-dihydro-1H-isochromen-1-yl)-N-methylethanamine;pentanedioic acid?
The canonical SMILES for (1R)-1-(8-fluoro-3,4-dihydro-1H-isochromen-1-yl)-N-methylethanamine;pentanedioic acid is CN[C@H](C)C1OCCc2cccc(F)c21.O=C(O)CCCC(=O)O.
What is the InChIKey of (1R)-1-(8-fluoro-3,4-dihydro-1H-isochromen-1-yl)-N-methylethanamine;pentanedioic acid?
The InChIKey is LVYHKZSTIMTVGE-CFKUEIMKSA-N. The full InChI is InChI=1S/C12H16FNO.C5H8O4/c1-8(14-2)12-11-9(6-7-15-12)4-3-5-10(11)13;6-4(7)2-1-3-5(8)9/h3-5,8,12,14H,6-7H2,1-2H3;1-3H2,(H,6,7)(H,8,9)/t8-,12?;/m1./s1.
What are the key properties of (1R)-1-(8-fluoro-3,4-dihydro-1H-isochromen-1-yl)-N-methylethanamine;pentanedioic acid?
(1R)-1-(8-fluoro-3,4-dihydro-1H-isochromen-1-yl)-N-methylethanamine;pentanedioic acid has a molecular weight of 341.38 g/mol, XLogP of 2.37, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-(8-fluoro-3,4-dihydro-1H-isochromen-1-yl)-N-methylethanamine;pentanedioic acid is sourced from PubChem (CID 175609770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).