About 1-[[(2E,4Z)-hexa-2,4-dien-3-yl]oxymethyl]piperidin-4-ol
1-[[(2E,4Z)-hexa-2,4-dien-3-yl]oxymethyl]piperidin-4-ol (PubChem CID 175609797) has the molecular formula C12H21NO2
and a molecular weight of 211.31 g/mol. Its IUPAC name is 1-[[(2E,4Z)-hexa-2,4-dien-3-yl]oxymethyl]piperidin-4-ol.
Molecular Properties
| Compound Name | 1-[[(2E,4Z)-hexa-2,4-dien-3-yl]oxymethyl]piperidin-4-ol |
| PubChem CID | 175609797 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | 1-[[(2E,4Z)-hexa-2,4-dien-3-yl]oxymethyl]piperidin-4-ol |
| SMILES | C/C=C\C(=C/C)OCN1CCC(O)CC1 |
| InChI | InChI=1S/C12H21NO2/c1-3-5-12(4-2)15-10-13-8-6-11(14)7-9-13/h3-5,11,14H,6-10H2,1-2H3/b5-3-,12-4+ |
| InChIKey | VEFQHLVKGPCGOZ-BVEFSZSYSA-N |
| XLogP | 1.90 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[[(2E,4Z)-hexa-2,4-dien-3-yl]oxymethyl]piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(2E,4Z)-hexa-2,4-dien-3-yl]oxymethyl]piperidin-4-ol?
The IUPAC name of 1-[[(2E,4Z)-hexa-2,4-dien-3-yl]oxymethyl]piperidin-4-ol (CID 175609797) is 1-[[(2E,4Z)-hexa-2,4-dien-3-yl]oxymethyl]piperidin-4-ol.
What is the SMILES notation for 1-[[(2E,4Z)-hexa-2,4-dien-3-yl]oxymethyl]piperidin-4-ol?
The canonical SMILES for 1-[[(2E,4Z)-hexa-2,4-dien-3-yl]oxymethyl]piperidin-4-ol is C/C=C\C(=C/C)OCN1CCC(O)CC1.
What is the InChIKey of 1-[[(2E,4Z)-hexa-2,4-dien-3-yl]oxymethyl]piperidin-4-ol?
The InChIKey is VEFQHLVKGPCGOZ-BVEFSZSYSA-N. The full InChI is InChI=1S/C12H21NO2/c1-3-5-12(4-2)15-10-13-8-6-11(14)7-9-13/h3-5,11,14H,6-10H2,1-2H3/b5-3-,12-4+.
What are the key properties of 1-[[(2E,4Z)-hexa-2,4-dien-3-yl]oxymethyl]piperidin-4-ol?
1-[[(2E,4Z)-hexa-2,4-dien-3-yl]oxymethyl]piperidin-4-ol has a molecular weight of 211.31 g/mol, XLogP of 1.90, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(2E,4Z)-hexa-2,4-dien-3-yl]oxymethyl]piperidin-4-ol is sourced from PubChem (CID 175609797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).