C15H12N2O2 — CID 17561
1,2-diphenylpyrazolidine-3,5-dione (PubChem CID 17561) has the molecular formula C15H12N2O2 and a molecular weight of 252.27 g/mol. Its IUPAC name is 1,2-diphenylpyrazolidine-3,5-dione.
| Compound Name | 1,2-diphenylpyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 17561 |
| Molecular Formula | C15H12N2O2 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 1,2-diphenylpyrazolidine-3,5-dione |
| SMILES | O=C1CC(=O)N(c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C15H12N2O2/c18-14-11-15(19)17(13-9-5-2-6-10-13)16(14)12-7-3-1-4-8-12/h1-10H,11H2 |
| InChIKey | XDPKQGKEOCYMQC-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|