About (2S)-2-methyl-3-[(3R,5R)-5-methyl-2-oxopyrrolidin-3-yl]propanal
(2S)-2-methyl-3-[(3R,5R)-5-methyl-2-oxopyrrolidin-3-yl]propanal (PubChem CID 175610759) has the molecular formula C9H15NO2
and a molecular weight of 169.22 g/mol. Its IUPAC name is (2S)-2-methyl-3-[(3R,5R)-5-methyl-2-oxopyrrolidin-3-yl]propanal.
Molecular Properties
| Compound Name | (2S)-2-methyl-3-[(3R,5R)-5-methyl-2-oxopyrrolidin-3-yl]propanal |
| PubChem CID | 175610759 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | (2S)-2-methyl-3-[(3R,5R)-5-methyl-2-oxopyrrolidin-3-yl]propanal |
| SMILES | C[C@H](C=O)C[C@@H]1C[C@@H](C)NC1=O |
| InChI | InChI=1S/C9H15NO2/c1-6(5-11)3-8-4-7(2)10-9(8)12/h5-8H,3-4H2,1-2H3,(H,10,12)/t6-,7+,8+/m0/s1 |
| InChIKey | OHCJQKOUJNKVMX-XLPZGREQSA-N |
| XLogP | 0.74 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-methyl-3-[(3R,5R)-5-methyl-2-oxopyrrolidin-3-yl]propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-methyl-3-[(3R,5R)-5-methyl-2-oxopyrrolidin-3-yl]propanal?
The IUPAC name of (2S)-2-methyl-3-[(3R,5R)-5-methyl-2-oxopyrrolidin-3-yl]propanal (CID 175610759) is (2S)-2-methyl-3-[(3R,5R)-5-methyl-2-oxopyrrolidin-3-yl]propanal.
What is the SMILES notation for (2S)-2-methyl-3-[(3R,5R)-5-methyl-2-oxopyrrolidin-3-yl]propanal?
The canonical SMILES for (2S)-2-methyl-3-[(3R,5R)-5-methyl-2-oxopyrrolidin-3-yl]propanal is C[C@H](C=O)C[C@@H]1C[C@@H](C)NC1=O.
What is the InChIKey of (2S)-2-methyl-3-[(3R,5R)-5-methyl-2-oxopyrrolidin-3-yl]propanal?
The InChIKey is OHCJQKOUJNKVMX-XLPZGREQSA-N. The full InChI is InChI=1S/C9H15NO2/c1-6(5-11)3-8-4-7(2)10-9(8)12/h5-8H,3-4H2,1-2H3,(H,10,12)/t6-,7+,8+/m0/s1.
What are the key properties of (2S)-2-methyl-3-[(3R,5R)-5-methyl-2-oxopyrrolidin-3-yl]propanal?
(2S)-2-methyl-3-[(3R,5R)-5-methyl-2-oxopyrrolidin-3-yl]propanal has a molecular weight of 169.22 g/mol, XLogP of 0.74, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-methyl-3-[(3R,5R)-5-methyl-2-oxopyrrolidin-3-yl]propanal is sourced from PubChem (CID 175610759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).