C28H37FN2 — CID 175610993
(3E,5E,7Z,9Z)-6-fluoro-N-[(E)-5-[3-[(3E)-5-iminopenta-1,3-dien-3-yl]cyclopentyl]pent-2-en-3-yl]-7-methyldodeca-1,3,5,7,9,11-hexaen-4-amine (PubChem CID 175610993) has the molecular formula C28H37FN2 and a molecular weight of 420.62 g/mol. Its IUPAC name is (3E,5E,7Z,9Z)-6-fluoro-N-[(E)-5-[3-[(3E)-5-iminopenta-1,3-dien-3-yl]cyclopentyl]pent-2-en-3-yl]-7-methyldodeca-1,3,5,7,9,11-hexaen-4-amine.
| Compound Name | (3E,5E,7Z,9Z)-6-fluoro-N-[(E)-5-[3-[(3E)-5-iminopenta-1,3-dien-3-yl]cyclopentyl]pent-2-en-3-yl]-7-methyldodeca-1,3,5,7,9,11-hexaen-4-amine |
|---|---|
| PubChem CID | 175610993 |
| Molecular Formula | C28H37FN2 |
| Molecular Weight | 420.62 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | (3E,5E,7Z,9Z)-6-fluoro-N-[(E)-5-[3-[(3E)-5-iminopenta-1,3-dien-3-yl]cyclopentyl]pent-2-en-3-yl]-7-methyldodeca-1,3,5,7,9,11-hexaen-4-amine |
| SMILES | [H]/N=C/C=C(\C=C)C1CCC(CC/C(=C\C)NC(=C/C=C)/C=C(F)\C(C)=C/C=C\C=C)C1 |
| InChI | InChI=1S/C28H37FN2/c1-6-10-11-13-22(5)28(29)21-27(12-7-2)31-26(9-4)17-15-23-14-16-25(20-23)24(8-3)18-19-30/h6-13,18-19,21,23,25,30-31H,1-3,14-17,20H2,4-5H3/b11-10-,22-13-,24-18+,26-9+,27-12+,28-21+,30-19+ |
| InChIKey | LMCRVBTYRDQAOJ-MRFUEOCHSA-N |
| XLogP | 8.05 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.62 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|