C34H45N3O2 — CID 175611557
(1S)-N-(6-amino-1-methyl-3,4,4a,9,10,10a-hexahydro-2H-phenanthrene-1-carbonyl)-1,4a-dimethyl-6-(methylamino)-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxamide (PubChem CID 175611557) has the molecular formula C34H45N3O2 and a molecular weight of 527.75 g/mol. Its IUPAC name is (1S)-N-(6-amino-1-methyl-3,4,4a,9,10,10a-hexahydro-2H-phenanthrene-1-carbonyl)-1,4a-dimethyl-6-(methylamino)-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxamide.
| Compound Name | (1S)-N-(6-amino-1-methyl-3,4,4a,9,10,10a-hexahydro-2H-phenanthrene-1-carbonyl)-1,4a-dimethyl-6-(methylamino)-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxamide |
|---|---|
| PubChem CID | 175611557 |
| Molecular Formula | C34H45N3O2 |
| Molecular Weight | 527.75 g/mol |
| Exact Mass | 527.35 |
| IUPAC Name | (1S)-N-(6-amino-1-methyl-3,4,4a,9,10,10a-hexahydro-2H-phenanthrene-1-carbonyl)-1,4a-dimethyl-6-(methylamino)-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxamide |
| SMILES | CNc1ccc2c(c1)C1(C)CCC[C@](C)(C(=O)NC(=O)C3(C)CCCC4c5cc(N)ccc5CCC43)C1CC2 |
| InChI | InChI=1S/C34H45N3O2/c1-32-17-6-18-34(3,29(32)15-11-22-9-13-24(36-4)20-28(22)32)31(39)37-30(38)33(2)16-5-7-25-26-19-23(35)12-8-21(26)10-14-27(25)33/h8-9,12-13,19-20,25,27,29,36H,5-7,10-11,14-18,35H2,1-4H3,(H,37,38,39)/t25?,27?,29?,32?,33?,34-/m0/s1 |
| InChIKey | GRLKOOGYOCMZMB-OWCSBXJPSA-N |
| XLogP | 6.50 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.75 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|