C20H28N2O4 — CID 175611568
6-(2,3-dihydroxypropanoylamino)-N,1-dimethyl-3,4,4a,9,10,10a-hexahydro-2H-phenanthrene-1-carboxamide (PubChem CID 175611568) has the molecular formula C20H28N2O4 and a molecular weight of 360.45 g/mol. Its IUPAC name is 6-(2,3-dihydroxypropanoylamino)-N,1-dimethyl-3,4,4a,9,10,10a-hexahydro-2H-phenanthrene-1-carboxamide.
| Compound Name | 6-(2,3-dihydroxypropanoylamino)-N,1-dimethyl-3,4,4a,9,10,10a-hexahydro-2H-phenanthrene-1-carboxamide |
|---|---|
| PubChem CID | 175611568 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 6-(2,3-dihydroxypropanoylamino)-N,1-dimethyl-3,4,4a,9,10,10a-hexahydro-2H-phenanthrene-1-carboxamide |
| SMILES | CNC(=O)C1(C)CCCC2c3cc(NC(=O)C(O)CO)ccc3CCC21 |
| InChI | InChI=1S/C20H28N2O4/c1-20(19(26)21-2)9-3-4-14-15-10-13(22-18(25)17(24)11-23)7-5-12(15)6-8-16(14)20/h5,7,10,14,16-17,23-24H,3-4,6,8-9,11H2,1-2H3,(H,21,26)(H,22,25) |
| InChIKey | DNPMTKFQMDOXIF-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |