C34H36N+ — CID 175611686
2-[4-[10-(1,2,3,8a-tetrahydronaphthalen-2-yl)-1,2,3,4,6,7-hexahydroanthracen-9-yl]cyclohexa-1,3-dien-1-yl]-3,4-dihydropyrrol-1-ium (PubChem CID 175611686) has the molecular formula C34H36N+ and a molecular weight of 458.67 g/mol. Its IUPAC name is 2-[4-[10-(1,2,3,8a-tetrahydronaphthalen-2-yl)-1,2,3,4,6,7-hexahydroanthracen-9-yl]cyclohexa-1,3-dien-1-yl]-3,4-dihydropyrrol-1-ium.
| Compound Name | 2-[4-[10-(1,2,3,8a-tetrahydronaphthalen-2-yl)-1,2,3,4,6,7-hexahydroanthracen-9-yl]cyclohexa-1,3-dien-1-yl]-3,4-dihydropyrrol-1-ium |
|---|---|
| PubChem CID | 175611686 |
| Molecular Formula | C34H36N+ |
| Molecular Weight | 458.67 g/mol |
| Exact Mass | 458.28 |
| IUPAC Name | 2-[4-[10-(1,2,3,8a-tetrahydronaphthalen-2-yl)-1,2,3,4,6,7-hexahydroanthracen-9-yl]cyclohexa-1,3-dien-1-yl]-3,4-dihydropyrrol-1-ium |
| SMILES | C1=CC2=CCC(c3c4c(c(C5=CC=C(C6=[N+]=CCC6)CC5)c5c3=CCCC=5)CCCC4)CC2C=C1 |
| InChI | InChI=1S/C34H36N/c1-2-9-26-22-27(20-15-23(26)8-1)34-30-12-5-3-10-28(30)33(29-11-4-6-13-31(29)34)25-18-16-24(17-19-25)32-14-7-21-35-32/h1-2,8-10,12,15-16,18,21,26-27H,3-7,11,13-14,17,19-20,22H2/q+1 |
| InChIKey | BPAMONVRXSFYLL-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.67 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|