C39H53N3 — CID 175611891
(8S)-8-[1-[(6-amino-4a-methyl-2,3,4,9,10,10a-hexahydro-1H-phenanthren-1-yl)methyl-ethenylamino]ethenyl]-4b,8-dimethyl-N-prop-1-en-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-3-amine (PubChem CID 175611891) has the molecular formula C39H53N3 and a molecular weight of 563.87 g/mol. Its IUPAC name is (8S)-8-[1-[(6-amino-4a-methyl-2,3,4,9,10,10a-hexahydro-1H-phenanthren-1-yl)methyl-ethenylamino]ethenyl]-4b,8-dimethyl-N-prop-1-en-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-3-amine.
| Compound Name | (8S)-8-[1-[(6-amino-4a-methyl-2,3,4,9,10,10a-hexahydro-1H-phenanthren-1-yl)methyl-ethenylamino]ethenyl]-4b,8-dimethyl-N-prop-1-en-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-3-amine |
|---|---|
| PubChem CID | 175611891 |
| Molecular Formula | C39H53N3 |
| Molecular Weight | 563.87 g/mol |
| Exact Mass | 563.42 |
| IUPAC Name | (8S)-8-[1-[(6-amino-4a-methyl-2,3,4,9,10,10a-hexahydro-1H-phenanthren-1-yl)methyl-ethenylamino]ethenyl]-4b,8-dimethyl-N-prop-1-en-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-3-amine |
| SMILES | C=CN(CC1CCCC2(C)c3cc(N)ccc3CCC12)C(=C)[C@@]1(C)CCCC2(C)c3cc(NC(=C)C)ccc3CCC21 |
| InChI | InChI=1S/C39H53N3/c1-8-42(25-30-11-9-20-38(6)33(30)18-14-28-12-16-31(40)23-34(28)38)27(4)37(5)21-10-22-39(7)35-24-32(41-26(2)3)17-13-29(35)15-19-36(37)39/h8,12-13,16-17,23-24,30,33,36,41H,1-2,4,9-11,14-15,18-22,25,40H2,3,5-7H3/t30?,33?,36?,37-,38?,39?/m1/s1 |
| InChIKey | PYNWOYWAJQREOB-FZXWNLOBSA-N |
| XLogP | 9.50 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.87 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|