About (2S)-4-fluoro-1,4-dimethyl-2-[(1S)-1-propan-2-yloxyethyl]piperidine
(2S)-4-fluoro-1,4-dimethyl-2-[(1S)-1-propan-2-yloxyethyl]piperidine (PubChem CID 175612157) has the molecular formula C12H24FNO
and a molecular weight of 217.33 g/mol. Its IUPAC name is (2S)-4-fluoro-1,4-dimethyl-2-[(1S)-1-propan-2-yloxyethyl]piperidine.
Molecular Properties
| Compound Name | (2S)-4-fluoro-1,4-dimethyl-2-[(1S)-1-propan-2-yloxyethyl]piperidine |
| PubChem CID | 175612157 |
| Molecular Formula | C12H24FNO |
| Molecular Weight | 217.33 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | (2S)-4-fluoro-1,4-dimethyl-2-[(1S)-1-propan-2-yloxyethyl]piperidine |
| SMILES | CC(C)O[C@@H](C)[C@@H]1CC(C)(F)CCN1C |
| InChI | InChI=1S/C12H24FNO/c1-9(2)15-10(3)11-8-12(4,13)6-7-14(11)5/h9-11H,6-8H2,1-5H3/t10-,11-,12?/m0/s1 |
| InChIKey | CEWJREIFQDIMKV-NDQFZYFBSA-N |
| XLogP | 2.62 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-4-fluoro-1,4-dimethyl-2-[(1S)-1-propan-2-yloxyethyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-4-fluoro-1,4-dimethyl-2-[(1S)-1-propan-2-yloxyethyl]piperidine?
The IUPAC name of (2S)-4-fluoro-1,4-dimethyl-2-[(1S)-1-propan-2-yloxyethyl]piperidine (CID 175612157) is (2S)-4-fluoro-1,4-dimethyl-2-[(1S)-1-propan-2-yloxyethyl]piperidine.
What is the SMILES notation for (2S)-4-fluoro-1,4-dimethyl-2-[(1S)-1-propan-2-yloxyethyl]piperidine?
The canonical SMILES for (2S)-4-fluoro-1,4-dimethyl-2-[(1S)-1-propan-2-yloxyethyl]piperidine is CC(C)O[C@@H](C)[C@@H]1CC(C)(F)CCN1C.
What is the InChIKey of (2S)-4-fluoro-1,4-dimethyl-2-[(1S)-1-propan-2-yloxyethyl]piperidine?
The InChIKey is CEWJREIFQDIMKV-NDQFZYFBSA-N. The full InChI is InChI=1S/C12H24FNO/c1-9(2)15-10(3)11-8-12(4,13)6-7-14(11)5/h9-11H,6-8H2,1-5H3/t10-,11-,12?/m0/s1.
What are the key properties of (2S)-4-fluoro-1,4-dimethyl-2-[(1S)-1-propan-2-yloxyethyl]piperidine?
(2S)-4-fluoro-1,4-dimethyl-2-[(1S)-1-propan-2-yloxyethyl]piperidine has a molecular weight of 217.33 g/mol, XLogP of 2.62, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4-fluoro-1,4-dimethyl-2-[(1S)-1-propan-2-yloxyethyl]piperidine is sourced from PubChem (CID 175612157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).