About (2S,4R)-1,4-dimethyl-2-[(1S)-1-[(2-methylpropan-2-yl)oxy]ethyl]pyrrolidine
(2S,4R)-1,4-dimethyl-2-[(1S)-1-[(2-methylpropan-2-yl)oxy]ethyl]pyrrolidine (PubChem CID 175612196) has the molecular formula C12H25NO
and a molecular weight of 199.34 g/mol. Its IUPAC name is (2S,4R)-1,4-dimethyl-2-[(1S)-1-[(2-methylpropan-2-yl)oxy]ethyl]pyrrolidine.
Molecular Properties
| Compound Name | (2S,4R)-1,4-dimethyl-2-[(1S)-1-[(2-methylpropan-2-yl)oxy]ethyl]pyrrolidine |
| PubChem CID | 175612196 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | (2S,4R)-1,4-dimethyl-2-[(1S)-1-[(2-methylpropan-2-yl)oxy]ethyl]pyrrolidine |
| SMILES | C[C@@H]1C[C@@H]([C@H](C)OC(C)(C)C)N(C)C1 |
| InChI | InChI=1S/C12H25NO/c1-9-7-11(13(6)8-9)10(2)14-12(3,4)5/h9-11H,7-8H2,1-6H3/t9-,10+,11+/m1/s1 |
| InChIKey | KKMCXEMCCDYTBQ-VWYCJHECSA-N |
| XLogP | 2.53 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S,4R)-1,4-dimethyl-2-[(1S)-1-[(2-methylpropan-2-yl)oxy]ethyl]pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,4R)-1,4-dimethyl-2-[(1S)-1-[(2-methylpropan-2-yl)oxy]ethyl]pyrrolidine?
The IUPAC name of (2S,4R)-1,4-dimethyl-2-[(1S)-1-[(2-methylpropan-2-yl)oxy]ethyl]pyrrolidine (CID 175612196) is (2S,4R)-1,4-dimethyl-2-[(1S)-1-[(2-methylpropan-2-yl)oxy]ethyl]pyrrolidine.
What is the SMILES notation for (2S,4R)-1,4-dimethyl-2-[(1S)-1-[(2-methylpropan-2-yl)oxy]ethyl]pyrrolidine?
The canonical SMILES for (2S,4R)-1,4-dimethyl-2-[(1S)-1-[(2-methylpropan-2-yl)oxy]ethyl]pyrrolidine is C[C@@H]1C[C@@H]([C@H](C)OC(C)(C)C)N(C)C1.
What is the InChIKey of (2S,4R)-1,4-dimethyl-2-[(1S)-1-[(2-methylpropan-2-yl)oxy]ethyl]pyrrolidine?
The InChIKey is KKMCXEMCCDYTBQ-VWYCJHECSA-N. The full InChI is InChI=1S/C12H25NO/c1-9-7-11(13(6)8-9)10(2)14-12(3,4)5/h9-11H,7-8H2,1-6H3/t9-,10+,11+/m1/s1.
What are the key properties of (2S,4R)-1,4-dimethyl-2-[(1S)-1-[(2-methylpropan-2-yl)oxy]ethyl]pyrrolidine?
(2S,4R)-1,4-dimethyl-2-[(1S)-1-[(2-methylpropan-2-yl)oxy]ethyl]pyrrolidine has a molecular weight of 199.34 g/mol, XLogP of 2.53, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4R)-1,4-dimethyl-2-[(1S)-1-[(2-methylpropan-2-yl)oxy]ethyl]pyrrolidine is sourced from PubChem (CID 175612196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).