About (5E)-1,2-ditert-butyl-5-(1-fluoroethylidene)azepane
(5E)-1,2-ditert-butyl-5-(1-fluoroethylidene)azepane (PubChem CID 175612271) has the molecular formula C16H30FN
and a molecular weight of 255.42 g/mol. Its IUPAC name is (5E)-1,2-ditert-butyl-5-(1-fluoroethylidene)azepane.
Molecular Properties
| Compound Name | (5E)-1,2-ditert-butyl-5-(1-fluoroethylidene)azepane |
| PubChem CID | 175612271 |
| Molecular Formula | C16H30FN |
| Molecular Weight | 255.42 g/mol |
| Exact Mass | 255.24 |
| IUPAC Name | (5E)-1,2-ditert-butyl-5-(1-fluoroethylidene)azepane |
| SMILES | C/C(F)=C1/CCC(C(C)(C)C)N(C(C)(C)C)CC1 |
| InChI | InChI=1S/C16H30FN/c1-12(17)13-8-9-14(15(2,3)4)18(11-10-13)16(5,6)7/h14H,8-11H2,1-7H3/b13-12+ |
| InChIKey | FOVAENXNPSKEFN-OUKQBFOZSA-N |
| XLogP | 4.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.42 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (5E)-1,2-ditert-butyl-5-(1-fluoroethylidene)azepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-1,2-ditert-butyl-5-(1-fluoroethylidene)azepane?
The IUPAC name of (5E)-1,2-ditert-butyl-5-(1-fluoroethylidene)azepane (CID 175612271) is (5E)-1,2-ditert-butyl-5-(1-fluoroethylidene)azepane.
What is the SMILES notation for (5E)-1,2-ditert-butyl-5-(1-fluoroethylidene)azepane?
The canonical SMILES for (5E)-1,2-ditert-butyl-5-(1-fluoroethylidene)azepane is C/C(F)=C1/CCC(C(C)(C)C)N(C(C)(C)C)CC1.
What is the InChIKey of (5E)-1,2-ditert-butyl-5-(1-fluoroethylidene)azepane?
The InChIKey is FOVAENXNPSKEFN-OUKQBFOZSA-N. The full InChI is InChI=1S/C16H30FN/c1-12(17)13-8-9-14(15(2,3)4)18(11-10-13)16(5,6)7/h14H,8-11H2,1-7H3/b13-12+.
What are the key properties of (5E)-1,2-ditert-butyl-5-(1-fluoroethylidene)azepane?
(5E)-1,2-ditert-butyl-5-(1-fluoroethylidene)azepane has a molecular weight of 255.42 g/mol, XLogP of 4.93, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-1,2-ditert-butyl-5-(1-fluoroethylidene)azepane is sourced from PubChem (CID 175612271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).