About (4R)-6-fluoro-3,4-dimethyl-1,3-oxazinane
(4R)-6-fluoro-3,4-dimethyl-1,3-oxazinane (PubChem CID 175612622) has the molecular formula C6H12FNO
and a molecular weight of 133.17 g/mol. Its IUPAC name is (4R)-6-fluoro-3,4-dimethyl-1,3-oxazinane.
Molecular Properties
| Compound Name | (4R)-6-fluoro-3,4-dimethyl-1,3-oxazinane |
| PubChem CID | 175612622 |
| Molecular Formula | C6H12FNO |
| Molecular Weight | 133.17 g/mol |
| Exact Mass | 133.09 |
| IUPAC Name | (4R)-6-fluoro-3,4-dimethyl-1,3-oxazinane |
| SMILES | C[C@@H]1CC(F)OCN1C |
| InChI | InChI=1S/C6H12FNO/c1-5-3-6(7)9-4-8(5)2/h5-6H,3-4H2,1-2H3/t5-,6?/m1/s1 |
| InChIKey | DKYDWQOWFJHRMN-LWOQYNTDSA-N |
| XLogP | 0.98 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.17 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4R)-6-fluoro-3,4-dimethyl-1,3-oxazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-6-fluoro-3,4-dimethyl-1,3-oxazinane?
The IUPAC name of (4R)-6-fluoro-3,4-dimethyl-1,3-oxazinane (CID 175612622) is (4R)-6-fluoro-3,4-dimethyl-1,3-oxazinane.
What is the SMILES notation for (4R)-6-fluoro-3,4-dimethyl-1,3-oxazinane?
The canonical SMILES for (4R)-6-fluoro-3,4-dimethyl-1,3-oxazinane is C[C@@H]1CC(F)OCN1C.
What is the InChIKey of (4R)-6-fluoro-3,4-dimethyl-1,3-oxazinane?
The InChIKey is DKYDWQOWFJHRMN-LWOQYNTDSA-N. The full InChI is InChI=1S/C6H12FNO/c1-5-3-6(7)9-4-8(5)2/h5-6H,3-4H2,1-2H3/t5-,6?/m1/s1.
What are the key properties of (4R)-6-fluoro-3,4-dimethyl-1,3-oxazinane?
(4R)-6-fluoro-3,4-dimethyl-1,3-oxazinane has a molecular weight of 133.17 g/mol, XLogP of 0.98, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-6-fluoro-3,4-dimethyl-1,3-oxazinane is sourced from PubChem (CID 175612622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).