C22H35FN2 — CID 175613106
1-cyclohexa-2,4-dien-1-yl-N'-[3-(cyclohexylmethyl)but-3-en-2-yl]-N-ethenyl-3-fluoropropane-1,3-diamine (PubChem CID 175613106) has the molecular formula C22H35FN2 and a molecular weight of 346.53 g/mol. Its IUPAC name is 1-cyclohexa-2,4-dien-1-yl-N'-[3-(cyclohexylmethyl)but-3-en-2-yl]-N-ethenyl-3-fluoropropane-1,3-diamine.
| Compound Name | 1-cyclohexa-2,4-dien-1-yl-N'-[3-(cyclohexylmethyl)but-3-en-2-yl]-N-ethenyl-3-fluoropropane-1,3-diamine |
|---|---|
| PubChem CID | 175613106 |
| Molecular Formula | C22H35FN2 |
| Molecular Weight | 346.53 g/mol |
| Exact Mass | 346.28 |
| IUPAC Name | 1-cyclohexa-2,4-dien-1-yl-N'-[3-(cyclohexylmethyl)but-3-en-2-yl]-N-ethenyl-3-fluoropropane-1,3-diamine |
| SMILES | C=CNC(CC(F)NC(C)C(=C)CC1CCCCC1)C1C=CC=CC1 |
| InChI | InChI=1S/C22H35FN2/c1-4-24-21(20-13-9-6-10-14-20)16-22(23)25-18(3)17(2)15-19-11-7-5-8-12-19/h4,6,9-10,13,18-22,24-25H,1-2,5,7-8,11-12,14-16H2,3H3 |
| InChIKey | ZRZUYXPTPMUCJU-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.53 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|