C18H21F2N3 — CID 175613342
(5R)-2-[1-(3,3-difluorocyclobutyl)ethenyl]-5-(1-methylcyclohexa-2,4-dien-1-yl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole (PubChem CID 175613342) has the molecular formula C18H21F2N3 and a molecular weight of 317.38 g/mol. Its IUPAC name is (5R)-2-[1-(3,3-difluorocyclobutyl)ethenyl]-5-(1-methylcyclohexa-2,4-dien-1-yl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole.
| Compound Name | (5R)-2-[1-(3,3-difluorocyclobutyl)ethenyl]-5-(1-methylcyclohexa-2,4-dien-1-yl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole |
|---|---|
| PubChem CID | 175613342 |
| Molecular Formula | C18H21F2N3 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | (5R)-2-[1-(3,3-difluorocyclobutyl)ethenyl]-5-(1-methylcyclohexa-2,4-dien-1-yl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole |
| SMILES | C=C(c1nc2n(n1)[C@@H](C1(C)C=CC=CC1)CC2)C1CC(F)(F)C1 |
| InChI | InChI=1S/C18H21F2N3/c1-12(13-10-18(19,20)11-13)16-21-15-7-6-14(23(15)22-16)17(2)8-4-3-5-9-17/h3-5,8,13-14H,1,6-7,9-11H2,2H3/t14-,17?/m1/s1 |
| InChIKey | JQKOTHAPFDOPQM-XPCCGILXSA-N |
| XLogP | 4.35 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |