About (3R)-3-(1-iodopropyl)-1,6-dimethylazepane
(3R)-3-(1-iodopropyl)-1,6-dimethylazepane (PubChem CID 175613384) has the molecular formula C11H22IN
and a molecular weight of 295.21 g/mol. Its IUPAC name is (3R)-3-(1-iodopropyl)-1,6-dimethylazepane.
Molecular Properties
| Compound Name | (3R)-3-(1-iodopropyl)-1,6-dimethylazepane |
| PubChem CID | 175613384 |
| Molecular Formula | C11H22IN |
| Molecular Weight | 295.21 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | (3R)-3-(1-iodopropyl)-1,6-dimethylazepane |
| SMILES | CCC(I)[C@@H]1CCC(C)CN(C)C1 |
| InChI | InChI=1S/C11H22IN/c1-4-11(12)10-6-5-9(2)7-13(3)8-10/h9-11H,4-8H2,1-3H3/t9?,10-,11?/m1/s1 |
| InChIKey | DTPOZVDPZCWONO-HSOILSAZSA-N |
| XLogP | 3.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.21 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-(1-iodopropyl)-1,6-dimethylazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-(1-iodopropyl)-1,6-dimethylazepane?
The IUPAC name of (3R)-3-(1-iodopropyl)-1,6-dimethylazepane (CID 175613384) is (3R)-3-(1-iodopropyl)-1,6-dimethylazepane.
What is the SMILES notation for (3R)-3-(1-iodopropyl)-1,6-dimethylazepane?
The canonical SMILES for (3R)-3-(1-iodopropyl)-1,6-dimethylazepane is CCC(I)[C@@H]1CCC(C)CN(C)C1.
What is the InChIKey of (3R)-3-(1-iodopropyl)-1,6-dimethylazepane?
The InChIKey is DTPOZVDPZCWONO-HSOILSAZSA-N. The full InChI is InChI=1S/C11H22IN/c1-4-11(12)10-6-5-9(2)7-13(3)8-10/h9-11H,4-8H2,1-3H3/t9?,10-,11?/m1/s1.
What are the key properties of (3R)-3-(1-iodopropyl)-1,6-dimethylazepane?
(3R)-3-(1-iodopropyl)-1,6-dimethylazepane has a molecular weight of 295.21 g/mol, XLogP of 3.18, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-(1-iodopropyl)-1,6-dimethylazepane is sourced from PubChem (CID 175613384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).