C19H26FN3 — CID 175613534
5-cyclohexa-2,4-dien-1-yl-2-(3,3-dimethylhex-1-en-2-yl)-7-fluoro-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole (PubChem CID 175613534) has the molecular formula C19H26FN3 and a molecular weight of 315.44 g/mol. Its IUPAC name is 5-cyclohexa-2,4-dien-1-yl-2-(3,3-dimethylhex-1-en-2-yl)-7-fluoro-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole.
| Compound Name | 5-cyclohexa-2,4-dien-1-yl-2-(3,3-dimethylhex-1-en-2-yl)-7-fluoro-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole |
|---|---|
| PubChem CID | 175613534 |
| Molecular Formula | C19H26FN3 |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.21 |
| IUPAC Name | 5-cyclohexa-2,4-dien-1-yl-2-(3,3-dimethylhex-1-en-2-yl)-7-fluoro-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole |
| SMILES | C=C(c1nc2n(n1)C(C1C=CC=CC1)CC2F)C(C)(C)CCC |
| InChI | InChI=1S/C19H26FN3/c1-5-11-19(3,4)13(2)17-21-18-15(20)12-16(23(18)22-17)14-9-7-6-8-10-14/h6-9,14-16H,2,5,10-12H2,1,3-4H3 |
| InChIKey | LKGJAHFJQVAFGH-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |