About 2-(difluoromethyl)-1,7-di(propan-2-yl)-1,4-diazepane
2-(difluoromethyl)-1,7-di(propan-2-yl)-1,4-diazepane (PubChem CID 175613599) has the molecular formula C12H24F2N2
and a molecular weight of 234.33 g/mol. Its IUPAC name is 2-(difluoromethyl)-1,7-di(propan-2-yl)-1,4-diazepane.
Molecular Properties
| Compound Name | 2-(difluoromethyl)-1,7-di(propan-2-yl)-1,4-diazepane |
| PubChem CID | 175613599 |
| Molecular Formula | C12H24F2N2 |
| Molecular Weight | 234.33 g/mol |
| Exact Mass | 234.19 |
| IUPAC Name | 2-(difluoromethyl)-1,7-di(propan-2-yl)-1,4-diazepane |
| SMILES | CC(C)C1CCNCC(C(F)F)N1C(C)C |
| InChI | InChI=1S/C12H24F2N2/c1-8(2)10-5-6-15-7-11(12(13)14)16(10)9(3)4/h8-12,15H,5-7H2,1-4H3 |
| InChIKey | PBQQREFNNLZQFI-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.33 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(difluoromethyl)-1,7-di(propan-2-yl)-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(difluoromethyl)-1,7-di(propan-2-yl)-1,4-diazepane?
The IUPAC name of 2-(difluoromethyl)-1,7-di(propan-2-yl)-1,4-diazepane (CID 175613599) is 2-(difluoromethyl)-1,7-di(propan-2-yl)-1,4-diazepane.
What is the SMILES notation for 2-(difluoromethyl)-1,7-di(propan-2-yl)-1,4-diazepane?
The canonical SMILES for 2-(difluoromethyl)-1,7-di(propan-2-yl)-1,4-diazepane is CC(C)C1CCNCC(C(F)F)N1C(C)C.
What is the InChIKey of 2-(difluoromethyl)-1,7-di(propan-2-yl)-1,4-diazepane?
The InChIKey is PBQQREFNNLZQFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24F2N2/c1-8(2)10-5-6-15-7-11(12(13)14)16(10)9(3)4/h8-12,15H,5-7H2,1-4H3.
What are the key properties of 2-(difluoromethyl)-1,7-di(propan-2-yl)-1,4-diazepane?
2-(difluoromethyl)-1,7-di(propan-2-yl)-1,4-diazepane has a molecular weight of 234.33 g/mol, XLogP of 2.35, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(difluoromethyl)-1,7-di(propan-2-yl)-1,4-diazepane is sourced from PubChem (CID 175613599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).