C7H5ClF4N2 — CID 175613693
2-(3-chloro-2,2,3,3-tetrafluoropropyl)pyrimidine (PubChem CID 175613693) has the molecular formula C7H5ClF4N2 and a molecular weight of 228.58 g/mol. Its IUPAC name is 2-(3-chloro-2,2,3,3-tetrafluoropropyl)pyrimidine.
| Compound Name | 2-(3-chloro-2,2,3,3-tetrafluoropropyl)pyrimidine |
|---|---|
| PubChem CID | 175613693 |
| Molecular Formula | C7H5ClF4N2 |
| Molecular Weight | 228.58 g/mol |
| Exact Mass | 228.01 |
| IUPAC Name | 2-(3-chloro-2,2,3,3-tetrafluoropropyl)pyrimidine |
| SMILES | FC(F)(Cl)C(F)(F)Cc1ncccn1 |
| InChI | InChI=1S/C7H5ClF4N2/c8-7(11,12)6(9,10)4-5-13-2-1-3-14-5/h1-3H,4H2 |
| InChIKey | PMAIENNYTCPLGO-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.58 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|