About 2-methyl-N-[(3E)-5-methyliminopenta-1,3-dien-3-yl]propanamide
2-methyl-N-[(3E)-5-methyliminopenta-1,3-dien-3-yl]propanamide (PubChem CID 175614047) has the molecular formula C10H16N2O
and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-methyl-N-[(3E)-5-methyliminopenta-1,3-dien-3-yl]propanamide.
Molecular Properties
| Compound Name | 2-methyl-N-[(3E)-5-methyliminopenta-1,3-dien-3-yl]propanamide |
| PubChem CID | 175614047 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 2-methyl-N-[(3E)-5-methyliminopenta-1,3-dien-3-yl]propanamide |
| SMILES | C=C/C(=C\C=N\C)NC(=O)C(C)C |
| InChI | InChI=1S/C10H16N2O/c1-5-9(6-7-11-4)12-10(13)8(2)3/h5-8H,1H2,2-4H3,(H,12,13)/b9-6+,11-7+ |
| InChIKey | PZCIGGQLMHFYTD-QHAIXMIYSA-N |
| XLogP | 1.53 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-N-[(3E)-5-methyliminopenta-1,3-dien-3-yl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-[(3E)-5-methyliminopenta-1,3-dien-3-yl]propanamide?
The IUPAC name of 2-methyl-N-[(3E)-5-methyliminopenta-1,3-dien-3-yl]propanamide (CID 175614047) is 2-methyl-N-[(3E)-5-methyliminopenta-1,3-dien-3-yl]propanamide.
What is the SMILES notation for 2-methyl-N-[(3E)-5-methyliminopenta-1,3-dien-3-yl]propanamide?
The canonical SMILES for 2-methyl-N-[(3E)-5-methyliminopenta-1,3-dien-3-yl]propanamide is C=C/C(=C\C=N\C)NC(=O)C(C)C.
What is the InChIKey of 2-methyl-N-[(3E)-5-methyliminopenta-1,3-dien-3-yl]propanamide?
The InChIKey is PZCIGGQLMHFYTD-QHAIXMIYSA-N. The full InChI is InChI=1S/C10H16N2O/c1-5-9(6-7-11-4)12-10(13)8(2)3/h5-8H,1H2,2-4H3,(H,12,13)/b9-6+,11-7+.
What are the key properties of 2-methyl-N-[(3E)-5-methyliminopenta-1,3-dien-3-yl]propanamide?
2-methyl-N-[(3E)-5-methyliminopenta-1,3-dien-3-yl]propanamide has a molecular weight of 180.25 g/mol, XLogP of 1.53, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-[(3E)-5-methyliminopenta-1,3-dien-3-yl]propanamide is sourced from PubChem (CID 175614047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).