C10H19NOS2 — CID 175614429
(4aS,7aR)-4a-(disulfanyloxymethyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-cyclopenta[b]pyridine (PubChem CID 175614429) has the molecular formula C10H19NOS2 and a molecular weight of 233.40 g/mol. Its IUPAC name is (4aS,7aR)-4a-(disulfanyloxymethyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-cyclopenta[b]pyridine.
| Compound Name | (4aS,7aR)-4a-(disulfanyloxymethyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-cyclopenta[b]pyridine |
|---|---|
| PubChem CID | 175614429 |
| Molecular Formula | C10H19NOS2 |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | (4aS,7aR)-4a-(disulfanyloxymethyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-cyclopenta[b]pyridine |
| SMILES | CN1CCC[C@@]2(COSS)CCC[C@@H]12 |
| InChI | InChI=1S/C10H19NOS2/c1-11-7-3-6-10(8-12-14-13)5-2-4-9(10)11/h9,13H,2-8H2,1H3/t9-,10-/m1/s1 |
| InChIKey | KPFBOEZAIMZMQR-NXEZZACHSA-N |
| XLogP | 2.76 |
| TPSA | 12.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|