C20H31FN2O2 — CID 175614528
5-[[(6Z)-6-(fluoromethylidene)-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl]methoxymethyl]-8-(methoxymethyl)-6-methylidene-2,3,5,7-tetrahydro-1H-pyrrolizine (PubChem CID 175614528) has the molecular formula C20H31FN2O2 and a molecular weight of 350.48 g/mol. Its IUPAC name is 5-[[(6Z)-6-(fluoromethylidene)-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl]methoxymethyl]-8-(methoxymethyl)-6-methylidene-2,3,5,7-tetrahydro-1H-pyrrolizine.
| Compound Name | 5-[[(6Z)-6-(fluoromethylidene)-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl]methoxymethyl]-8-(methoxymethyl)-6-methylidene-2,3,5,7-tetrahydro-1H-pyrrolizine |
|---|---|
| PubChem CID | 175614528 |
| Molecular Formula | C20H31FN2O2 |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | 5-[[(6Z)-6-(fluoromethylidene)-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl]methoxymethyl]-8-(methoxymethyl)-6-methylidene-2,3,5,7-tetrahydro-1H-pyrrolizine |
| SMILES | C=C1CC2(COC)CCCN2C1COCC12CCCN1C/C(=C\F)C2 |
| InChI | InChI=1S/C20H31FN2O2/c1-16-9-20(14-24-2)6-4-8-23(20)18(16)13-25-15-19-5-3-7-22(19)12-17(10-19)11-21/h11,18H,1,3-10,12-15H2,2H3/b17-11- |
| InChIKey | WFXSMJPWTRWCQE-BOPFTXTBSA-N |
| XLogP | 2.90 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|