C23H22FN6P — CID 175614766
[2-[13-(4-ethynylpiperidin-1-yl)-5-methyl-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2,5,7,10,12-hexaen-8-yl]-3-fluorophenyl]phosphane (PubChem CID 175614766) has the molecular formula C23H22FN6P and a molecular weight of 432.44 g/mol. Its IUPAC name is [2-[13-(4-ethynylpiperidin-1-yl)-5-methyl-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2,5,7,10,12-hexaen-8-yl]-3-fluorophenyl]phosphane.
| Compound Name | [2-[13-(4-ethynylpiperidin-1-yl)-5-methyl-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2,5,7,10,12-hexaen-8-yl]-3-fluorophenyl]phosphane |
|---|---|
| PubChem CID | 175614766 |
| Molecular Formula | C23H22FN6P |
| Molecular Weight | 432.44 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | [2-[13-(4-ethynylpiperidin-1-yl)-5-methyl-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2,5,7,10,12-hexaen-8-yl]-3-fluorophenyl]phosphane |
| SMILES | C#CC1CCN(c2cc3c(cn2)NC(c2c(F)cccc2P)=Nc2c-3n[nH]c2C)CC1 |
| InChI | InChI=1S/C23H22FN6P/c1-3-14-7-9-30(10-8-14)19-11-15-17(12-25-19)26-23(20-16(24)5-4-6-18(20)31)27-21-13(2)28-29-22(15)21/h1,4-6,11-12,14H,7-10,31H2,2H3,(H,26,27)(H,28,29) |
| InChIKey | WOLASXPMLUBZBW-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|