C9H14N2O — CID 175615809
4,6-diethyl-1,7-dihydro-1,3-diazepin-2-one (PubChem CID 175615809) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is 4,6-diethyl-1,7-dihydro-1,3-diazepin-2-one.
| Compound Name | 4,6-diethyl-1,7-dihydro-1,3-diazepin-2-one |
|---|---|
| PubChem CID | 175615809 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 4,6-diethyl-1,7-dihydro-1,3-diazepin-2-one |
| SMILES | CCC1=CC(CC)=NC(=O)NC1 |
| InChI | InChI=1S/C9H14N2O/c1-3-7-5-8(4-2)11-9(12)10-6-7/h5H,3-4,6H2,1-2H3,(H,10,12) |
| InChIKey | CKBLEABZGBVVOO-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |