C27H27FN4O3 — CID 175615880
6-[[2-fluoro-4-[2-methyl-7-(2-propan-2-yloxyethoxy)indazol-4-yl]phenyl]methyl]-7H-pyrrolo[3,4-b]pyridin-5-one (PubChem CID 175615880) has the molecular formula C27H27FN4O3 and a molecular weight of 474.54 g/mol. Its IUPAC name is 6-[[2-fluoro-4-[2-methyl-7-(2-propan-2-yloxyethoxy)indazol-4-yl]phenyl]methyl]-7H-pyrrolo[3,4-b]pyridin-5-one.
| Compound Name | 6-[[2-fluoro-4-[2-methyl-7-(2-propan-2-yloxyethoxy)indazol-4-yl]phenyl]methyl]-7H-pyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 175615880 |
| Molecular Formula | C27H27FN4O3 |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | 6-[[2-fluoro-4-[2-methyl-7-(2-propan-2-yloxyethoxy)indazol-4-yl]phenyl]methyl]-7H-pyrrolo[3,4-b]pyridin-5-one |
| SMILES | CC(C)OCCOc1ccc(-c2ccc(CN3Cc4ncccc4C3=O)c(F)c2)c2cn(C)nc12 |
| InChI | InChI=1S/C27H27FN4O3/c1-17(2)34-11-12-35-25-9-8-20(22-15-31(3)30-26(22)25)18-6-7-19(23(28)13-18)14-32-16-24-21(27(32)33)5-4-10-29-24/h4-10,13,15,17H,11-12,14,16H2,1-3H3 |
| InChIKey | KBZGOALOOGDRRI-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|