C28H26FN3O — CID 175616902
2-[3-[2-[(2S,5R)-3-(4-fluorobicyclo[2.2.1]heptane-1-carbonyl)-5-methyl-3,10-diazatricyclo[5.4.0.02,6]undeca-1(7),8,10-trien-8-yl]ethynyl]phenyl]acetonitrile (PubChem CID 175616902) has the molecular formula C28H26FN3O and a molecular weight of 439.53 g/mol. Its IUPAC name is 2-[3-[2-[(2S,5R)-3-(4-fluorobicyclo[2.2.1]heptane-1-carbonyl)-5-methyl-3,10-diazatricyclo[5.4.0.02,6]undeca-1(7),8,10-trien-8-yl]ethynyl]phenyl]acetonitrile.
| Compound Name | 2-[3-[2-[(2S,5R)-3-(4-fluorobicyclo[2.2.1]heptane-1-carbonyl)-5-methyl-3,10-diazatricyclo[5.4.0.02,6]undeca-1(7),8,10-trien-8-yl]ethynyl]phenyl]acetonitrile |
|---|---|
| PubChem CID | 175616902 |
| Molecular Formula | C28H26FN3O |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | 2-[3-[2-[(2S,5R)-3-(4-fluorobicyclo[2.2.1]heptane-1-carbonyl)-5-methyl-3,10-diazatricyclo[5.4.0.02,6]undeca-1(7),8,10-trien-8-yl]ethynyl]phenyl]acetonitrile |
| SMILES | C[C@H]1CN(C(=O)C23CCC(F)(CC2)C3)[C@@H]2c3cncc(C#Cc4cccc(CC#N)c4)c3C21 |
| InChI | InChI=1S/C28H26FN3O/c1-18-16-32(26(33)27-8-10-28(29,17-27)11-9-27)25-22-15-31-14-21(24(22)23(18)25)6-5-19-3-2-4-20(13-19)7-12-30/h2-4,13-15,18,23,25H,7-11,16-17H2,1H3/t18-,23?,25+,27?,28?/m0/s1 |
| InChIKey | BYHWPZSGBSTCTR-FEAUGCBLSA-N |
| XLogP | 4.84 |
| TPSA | 56.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|