C15H17ClN4O — CID 175616914
trans-(1S,2S)-N-[C-[(E)-2-chloro-2-(methylideneamino)ethenyl]-N-methylcarbonimidoyl]-2-(4-methyl-2-pyridinyl)cyclopropane-1-carboxamide (PubChem CID 175616914) has the molecular formula C15H17ClN4O and a molecular weight of 304.78 g/mol. Its IUPAC name is trans-(1S,2S)-N-[C-[(E)-2-chloro-2-(methylideneamino)ethenyl]-N-methylcarbonimidoyl]-2-(4-methyl-2-pyridinyl)cyclopropane-1-carboxamide.
| Compound Name | trans-(1S,2S)-N-[C-[(E)-2-chloro-2-(methylideneamino)ethenyl]-N-methylcarbonimidoyl]-2-(4-methyl-2-pyridinyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 175616914 |
| Molecular Formula | C15H17ClN4O |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | trans-(1S,2S)-N-[C-[(E)-2-chloro-2-(methylideneamino)ethenyl]-N-methylcarbonimidoyl]-2-(4-methyl-2-pyridinyl)cyclopropane-1-carboxamide |
| SMILES | C=N/C(Cl)=C\C(=N/C)NC(=O)[C@H]1C[C@@H]1c1cc(C)ccn1 |
| InChI | InChI=1S/C15H17ClN4O/c1-9-4-5-19-12(6-9)10-7-11(10)15(21)20-14(18-3)8-13(16)17-2/h4-6,8,10-11H,2,7H2,1,3H3,(H,18,20,21)/b13-8-/t10-,11-/m0/s1 |
| InChIKey | XOIOGFBDWLHNDK-RITGAEKQSA-N |
| XLogP | 2.42 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|