C22H23N9O3 — CID 175616978
N-[4-cyclopropyl-6-[[6-cyclopropyl-8-(2,4-dioxoimidazolidin-1-yl)imidazo[1,2-a]pyridin-2-yl]methyl-methylamino]-1,3,5-triazin-2-yl]formamide (PubChem CID 175616978) has the molecular formula C22H23N9O3 and a molecular weight of 461.49 g/mol. Its IUPAC name is N-[4-cyclopropyl-6-[[6-cyclopropyl-8-(2,4-dioxoimidazolidin-1-yl)imidazo[1,2-a]pyridin-2-yl]methyl-methylamino]-1,3,5-triazin-2-yl]formamide.
| Compound Name | N-[4-cyclopropyl-6-[[6-cyclopropyl-8-(2,4-dioxoimidazolidin-1-yl)imidazo[1,2-a]pyridin-2-yl]methyl-methylamino]-1,3,5-triazin-2-yl]formamide |
|---|---|
| PubChem CID | 175616978 |
| Molecular Formula | C22H23N9O3 |
| Molecular Weight | 461.49 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | N-[4-cyclopropyl-6-[[6-cyclopropyl-8-(2,4-dioxoimidazolidin-1-yl)imidazo[1,2-a]pyridin-2-yl]methyl-methylamino]-1,3,5-triazin-2-yl]formamide |
| SMILES | CN(Cc1cn2cc(C3CC3)cc(N3CC(=O)NC3=O)c2n1)c1nc(NC=O)nc(C2CC2)n1 |
| InChI | InChI=1S/C22H23N9O3/c1-29(21-27-18(13-4-5-13)26-20(28-21)23-11-32)8-15-9-30-7-14(12-2-3-12)6-16(19(30)24-15)31-10-17(33)25-22(31)34/h6-7,9,11-13H,2-5,8,10H2,1H3,(H,25,33,34)(H,23,26,27,28,32) |
| InChIKey | SAOIJKLIPCFHRM-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 137.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.49 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|