About 5-ethyl-1-(2,2,2-trifluoroethyl)-2H-pyridin-2-ol
5-ethyl-1-(2,2,2-trifluoroethyl)-2H-pyridin-2-ol (PubChem CID 175617349) has the molecular formula C9H12F3NO
and a molecular weight of 207.19 g/mol. Its IUPAC name is 5-ethyl-1-(2,2,2-trifluoroethyl)-2H-pyridin-2-ol.
Molecular Properties
| Compound Name | 5-ethyl-1-(2,2,2-trifluoroethyl)-2H-pyridin-2-ol |
| PubChem CID | 175617349 |
| Molecular Formula | C9H12F3NO |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 5-ethyl-1-(2,2,2-trifluoroethyl)-2H-pyridin-2-ol |
| SMILES | CCC1=CN(CC(F)(F)F)C(O)C=C1 |
| InChI | InChI=1S/C9H12F3NO/c1-2-7-3-4-8(14)13(5-7)6-9(10,11)12/h3-5,8,14H,2,6H2,1H3 |
| InChIKey | MWYUQRWPRWGHQH-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-ethyl-1-(2,2,2-trifluoroethyl)-2H-pyridin-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-1-(2,2,2-trifluoroethyl)-2H-pyridin-2-ol?
The IUPAC name of 5-ethyl-1-(2,2,2-trifluoroethyl)-2H-pyridin-2-ol (CID 175617349) is 5-ethyl-1-(2,2,2-trifluoroethyl)-2H-pyridin-2-ol.
What is the SMILES notation for 5-ethyl-1-(2,2,2-trifluoroethyl)-2H-pyridin-2-ol?
The canonical SMILES for 5-ethyl-1-(2,2,2-trifluoroethyl)-2H-pyridin-2-ol is CCC1=CN(CC(F)(F)F)C(O)C=C1.
What is the InChIKey of 5-ethyl-1-(2,2,2-trifluoroethyl)-2H-pyridin-2-ol?
The InChIKey is MWYUQRWPRWGHQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F3NO/c1-2-7-3-4-8(14)13(5-7)6-9(10,11)12/h3-5,8,14H,2,6H2,1H3.
What are the key properties of 5-ethyl-1-(2,2,2-trifluoroethyl)-2H-pyridin-2-ol?
5-ethyl-1-(2,2,2-trifluoroethyl)-2H-pyridin-2-ol has a molecular weight of 207.19 g/mol, XLogP of 2.03, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-1-(2,2,2-trifluoroethyl)-2H-pyridin-2-ol is sourced from PubChem (CID 175617349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).