C29H40O7S2 — CID 175617457
11-[(3,5-dimethyl-2-sulfophenyl)methyl]-20-hydroxytricyclo[14.3.1.08,18]icosa-1(20),16,18-triene-8-sulfonic acid (PubChem CID 175617457) has the molecular formula C29H40O7S2 and a molecular weight of 564.77 g/mol. Its IUPAC name is 11-[(3,5-dimethyl-2-sulfophenyl)methyl]-20-hydroxytricyclo[14.3.1.08,18]icosa-1(20),16,18-triene-8-sulfonic acid.
| Compound Name | 11-[(3,5-dimethyl-2-sulfophenyl)methyl]-20-hydroxytricyclo[14.3.1.08,18]icosa-1(20),16,18-triene-8-sulfonic acid |
|---|---|
| PubChem CID | 175617457 |
| Molecular Formula | C29H40O7S2 |
| Molecular Weight | 564.77 g/mol |
| Exact Mass | 564.22 |
| IUPAC Name | 11-[(3,5-dimethyl-2-sulfophenyl)methyl]-20-hydroxytricyclo[14.3.1.08,18]icosa-1(20),16,18-triene-8-sulfonic acid |
| SMILES | Cc1cc(C)c(S(=O)(=O)O)c(CC2CCCCc3cc4cc(c3O)CCCCCCC4(S(=O)(=O)O)CC2)c1 |
| InChI | InChI=1S/C29H40O7S2/c1-20-15-21(2)28(37(31,32)33)25(16-20)17-22-9-6-7-11-24-19-26-18-23(27(24)30)10-5-3-4-8-13-29(26,14-12-22)38(34,35)36/h15-16,18-19,22,30H,3-14,17H2,1-2H3,(H,31,32,33)(H,34,35,36) |
| InChIKey | DPACNODBVIXFBS-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.77 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|