About 5,5-dibromo-6,7-dihydro-1H-inden-4-one
5,5-dibromo-6,7-dihydro-1H-inden-4-one (PubChem CID 175617865) has the molecular formula C9H8Br2O
and a molecular weight of 291.97 g/mol. Its IUPAC name is 5,5-dibromo-6,7-dihydro-1H-inden-4-one.
Molecular Properties
| Compound Name | 5,5-dibromo-6,7-dihydro-1H-inden-4-one |
| PubChem CID | 175617865 |
| Molecular Formula | C9H8Br2O |
| Molecular Weight | 291.97 g/mol |
| Exact Mass | 289.89 |
| IUPAC Name | 5,5-dibromo-6,7-dihydro-1H-inden-4-one |
| SMILES | O=C1C2=C(CC=C2)CCC1(Br)Br |
| InChI | InChI=1S/C9H8Br2O/c10-9(11)5-4-6-2-1-3-7(6)8(9)12/h1,3H,2,4-5H2 |
| InChIKey | ZQLWSPZNFOICJU-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.97 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5,5-dibromo-6,7-dihydro-1H-inden-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dibromo-6,7-dihydro-1H-inden-4-one?
The IUPAC name of 5,5-dibromo-6,7-dihydro-1H-inden-4-one (CID 175617865) is 5,5-dibromo-6,7-dihydro-1H-inden-4-one.
What is the SMILES notation for 5,5-dibromo-6,7-dihydro-1H-inden-4-one?
The canonical SMILES for 5,5-dibromo-6,7-dihydro-1H-inden-4-one is O=C1C2=C(CC=C2)CCC1(Br)Br.
What is the InChIKey of 5,5-dibromo-6,7-dihydro-1H-inden-4-one?
The InChIKey is ZQLWSPZNFOICJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8Br2O/c10-9(11)5-4-6-2-1-3-7(6)8(9)12/h1,3H,2,4-5H2.
What are the key properties of 5,5-dibromo-6,7-dihydro-1H-inden-4-one?
5,5-dibromo-6,7-dihydro-1H-inden-4-one has a molecular weight of 291.97 g/mol, XLogP of 3.09, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dibromo-6,7-dihydro-1H-inden-4-one is sourced from PubChem (CID 175617865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).