About 4-chloro-5,7-dihydrofuro[3,4-d]pyridazin-1-amine
4-chloro-5,7-dihydrofuro[3,4-d]pyridazin-1-amine (PubChem CID 175617902) has the molecular formula C6H6ClN3O
and a molecular weight of 171.59 g/mol. Its IUPAC name is 4-chloro-5,7-dihydrofuro[3,4-d]pyridazin-1-amine.
Molecular Properties
| Compound Name | 4-chloro-5,7-dihydrofuro[3,4-d]pyridazin-1-amine |
| PubChem CID | 175617902 |
| Molecular Formula | C6H6ClN3O |
| Molecular Weight | 171.59 g/mol |
| Exact Mass | 171.02 |
| IUPAC Name | 4-chloro-5,7-dihydrofuro[3,4-d]pyridazin-1-amine |
| SMILES | Nc1nnc(Cl)c2c1COC2 |
| InChI | InChI=1S/C6H6ClN3O/c7-5-3-1-11-2-4(3)6(8)10-9-5/h1-2H2,(H2,8,10) |
| InChIKey | QRAAIRREXHWPBG-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.59 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-chloro-5,7-dihydrofuro[3,4-d]pyridazin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-5,7-dihydrofuro[3,4-d]pyridazin-1-amine?
The IUPAC name of 4-chloro-5,7-dihydrofuro[3,4-d]pyridazin-1-amine (CID 175617902) is 4-chloro-5,7-dihydrofuro[3,4-d]pyridazin-1-amine.
What is the SMILES notation for 4-chloro-5,7-dihydrofuro[3,4-d]pyridazin-1-amine?
The canonical SMILES for 4-chloro-5,7-dihydrofuro[3,4-d]pyridazin-1-amine is Nc1nnc(Cl)c2c1COC2.
What is the InChIKey of 4-chloro-5,7-dihydrofuro[3,4-d]pyridazin-1-amine?
The InChIKey is QRAAIRREXHWPBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6ClN3O/c7-5-3-1-11-2-4(3)6(8)10-9-5/h1-2H2,(H2,8,10).
What are the key properties of 4-chloro-5,7-dihydrofuro[3,4-d]pyridazin-1-amine?
4-chloro-5,7-dihydrofuro[3,4-d]pyridazin-1-amine has a molecular weight of 171.59 g/mol, XLogP of 0.74, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-5,7-dihydrofuro[3,4-d]pyridazin-1-amine is sourced from PubChem (CID 175617902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).