C38H29NO6 — CID 175618078
17-anthracen-9-yl-4,5,10,11,20-pentamethoxy-18-oxa-16-azapentacyclo[12.7.0.02,7.08,13.015,19]henicosa-1(21),2,4,6,8,10,12,14,16,19-decaene (PubChem CID 175618078) has the molecular formula C38H29NO6 and a molecular weight of 595.65 g/mol. Its IUPAC name is 17-anthracen-9-yl-4,5,10,11,20-pentamethoxy-18-oxa-16-azapentacyclo[12.7.0.02,7.08,13.015,19]henicosa-1(21),2,4,6,8,10,12,14,16,19-decaene.
| Compound Name | 17-anthracen-9-yl-4,5,10,11,20-pentamethoxy-18-oxa-16-azapentacyclo[12.7.0.02,7.08,13.015,19]henicosa-1(21),2,4,6,8,10,12,14,16,19-decaene |
|---|---|
| PubChem CID | 175618078 |
| Molecular Formula | C38H29NO6 |
| Molecular Weight | 595.65 g/mol |
| Exact Mass | 595.20 |
| IUPAC Name | 17-anthracen-9-yl-4,5,10,11,20-pentamethoxy-18-oxa-16-azapentacyclo[12.7.0.02,7.08,13.015,19]henicosa-1(21),2,4,6,8,10,12,14,16,19-decaene |
| SMILES | COc1cc2c3cc(OC)c(OC)cc3c3c(cc(OC)c4oc(-c5c6ccccc6cc6ccccc56)nc43)c2cc1OC |
| InChI | InChI=1S/C38H29NO6/c1-40-29-15-24-25-16-31(42-3)32(43-4)18-27(25)34-28(26(24)17-30(29)41-2)19-33(44-5)37-36(34)39-38(45-37)35-22-12-8-6-10-20(22)14-21-11-7-9-13-23(21)35/h6-19H,1-5H3 |
| InChIKey | OXWZRXIDEHYPQH-UHFFFAOYSA-N |
| XLogP | 9.30 |
| TPSA | 72.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.65 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|