C25H38F6O4 — CID 175618244
1,3-bis[2,2-dimethyl-1-(2,2,2-trifluoroethoxy)propoxy]-5-ethyl-2-propan-2-ylbenzene (PubChem CID 175618244) has the molecular formula C25H38F6O4 and a molecular weight of 516.56 g/mol. Its IUPAC name is 1,3-bis[2,2-dimethyl-1-(2,2,2-trifluoroethoxy)propoxy]-5-ethyl-2-propan-2-ylbenzene.
| Compound Name | 1,3-bis[2,2-dimethyl-1-(2,2,2-trifluoroethoxy)propoxy]-5-ethyl-2-propan-2-ylbenzene |
|---|---|
| PubChem CID | 175618244 |
| Molecular Formula | C25H38F6O4 |
| Molecular Weight | 516.56 g/mol |
| Exact Mass | 516.27 |
| IUPAC Name | 1,3-bis[2,2-dimethyl-1-(2,2,2-trifluoroethoxy)propoxy]-5-ethyl-2-propan-2-ylbenzene |
| SMILES | CCc1cc(OC(OCC(F)(F)F)C(C)(C)C)c(C(C)C)c(OC(OCC(F)(F)F)C(C)(C)C)c1 |
| InChI | InChI=1S/C25H38F6O4/c1-10-16-11-17(34-20(22(4,5)6)32-13-24(26,27)28)19(15(2)3)18(12-16)35-21(23(7,8)9)33-14-25(29,30)31/h11-12,15,20-21H,10,13-14H2,1-9H3 |
| InChIKey | AMVNFEHIDUZBFO-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.56 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|