C16H24N2 — CID 175618611
6-tert-butyl-5-pentan-2-ylpyrrolo[1,2-b]pyridazine (PubChem CID 175618611) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 6-tert-butyl-5-pentan-2-ylpyrrolo[1,2-b]pyridazine.
| Compound Name | 6-tert-butyl-5-pentan-2-ylpyrrolo[1,2-b]pyridazine |
|---|---|
| PubChem CID | 175618611 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 6-tert-butyl-5-pentan-2-ylpyrrolo[1,2-b]pyridazine |
| SMILES | CCCC(C)c1c(C(C)(C)C)cn2ncccc12 |
| InChI | InChI=1S/C16H24N2/c1-6-8-12(2)15-13(16(3,4)5)11-18-14(15)9-7-10-17-18/h7,9-12H,6,8H2,1-5H3 |
| InChIKey | DKJUSYQXMMBVAO-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |