C16H30O2 — CID 175618710
(3S,4S,5R)-6-but-3-enoxy-2,2-diethyl-3,4,5-trimethyloxane (PubChem CID 175618710) has the molecular formula C16H30O2 and a molecular weight of 254.41 g/mol. Its IUPAC name is (3S,4S,5R)-6-but-3-enoxy-2,2-diethyl-3,4,5-trimethyloxane.
| Compound Name | (3S,4S,5R)-6-but-3-enoxy-2,2-diethyl-3,4,5-trimethyloxane |
|---|---|
| PubChem CID | 175618710 |
| Molecular Formula | C16H30O2 |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | (3S,4S,5R)-6-but-3-enoxy-2,2-diethyl-3,4,5-trimethyloxane |
| SMILES | C=CCCOC1OC(CC)(CC)[C@@H](C)[C@H](C)[C@H]1C |
| InChI | InChI=1S/C16H30O2/c1-7-10-11-17-15-13(5)12(4)14(6)16(8-2,9-3)18-15/h7,12-15H,1,8-11H2,2-6H3/t12-,13-,14+,15?/m1/s1 |
| InChIKey | FVNOHKZZVAXWSK-JKXDFHQYSA-N |
| XLogP | 4.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|