C19H19F3N7O3S+ — CID 175619831
5-imidazo[1,2-a]pyrimidin-2-yl-1-[(4-methoxyphenyl)methyl]-N,N-dimethyl-3-(trifluoromethyl)-1,2,4-triazol-4-ium-4-sulfonamide (PubChem CID 175619831) has the molecular formula C19H19F3N7O3S+ and a molecular weight of 482.47 g/mol. Its IUPAC name is 5-imidazo[1,2-a]pyrimidin-2-yl-1-[(4-methoxyphenyl)methyl]-N,N-dimethyl-3-(trifluoromethyl)-1,2,4-triazol-4-ium-4-sulfonamide.
| Compound Name | 5-imidazo[1,2-a]pyrimidin-2-yl-1-[(4-methoxyphenyl)methyl]-N,N-dimethyl-3-(trifluoromethyl)-1,2,4-triazol-4-ium-4-sulfonamide |
|---|---|
| PubChem CID | 175619831 |
| Molecular Formula | C19H19F3N7O3S+ |
| Molecular Weight | 482.47 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | 5-imidazo[1,2-a]pyrimidin-2-yl-1-[(4-methoxyphenyl)methyl]-N,N-dimethyl-3-(trifluoromethyl)-1,2,4-triazol-4-ium-4-sulfonamide |
| SMILES | COc1ccc(Cn2nc(C(F)(F)F)[n+](S(=O)(=O)N(C)C)c2-c2cn3cccnc3n2)cc1 |
| InChI | InChI=1S/C19H19F3N7O3S/c1-26(2)33(30,31)29-16(15-12-27-10-4-9-23-18(27)24-15)28(25-17(29)19(20,21)22)11-13-5-7-14(32-3)8-6-13/h4-10,12H,11H2,1-3H3/q+1 |
| InChIKey | BTYSDQAEXIATMN-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 98.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.47 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|