C19H28N2O3 — CID 175619937
N-methyl-2-[3-methyl-4-[(3Z,5E)-2-methylhepta-3,5-dien-3-yl]-5-oxo-2H-pyrrol-1-yl]-5-oxopentanamide (PubChem CID 175619937) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is N-methyl-2-[3-methyl-4-[(3Z,5E)-2-methylhepta-3,5-dien-3-yl]-5-oxo-2H-pyrrol-1-yl]-5-oxopentanamide.
| Compound Name | N-methyl-2-[3-methyl-4-[(3Z,5E)-2-methylhepta-3,5-dien-3-yl]-5-oxo-2H-pyrrol-1-yl]-5-oxopentanamide |
|---|---|
| PubChem CID | 175619937 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | N-methyl-2-[3-methyl-4-[(3Z,5E)-2-methylhepta-3,5-dien-3-yl]-5-oxo-2H-pyrrol-1-yl]-5-oxopentanamide |
| SMILES | C/C=C/C=C(\C1=C(C)CN(C(CCC=O)C(=O)NC)C1=O)C(C)C |
| InChI | InChI=1S/C19H28N2O3/c1-6-7-9-15(13(2)3)17-14(4)12-21(19(17)24)16(10-8-11-22)18(23)20-5/h6-7,9,11,13,16H,8,10,12H2,1-5H3,(H,20,23)/b7-6+,15-9- |
| InChIKey | WKBAGLFJPZMAJI-MOKCJYBKSA-N |
| XLogP | 2.40 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|