C19H25N3O3 — CID 175620494
N-(2,6-dioxopiperidin-3-yl)-6-methyl-6-propan-2-yl-7,8-dihydro-5H-isoquinoline-3-carboxamide (PubChem CID 175620494) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-6-methyl-6-propan-2-yl-7,8-dihydro-5H-isoquinoline-3-carboxamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-6-methyl-6-propan-2-yl-7,8-dihydro-5H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 175620494 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-6-methyl-6-propan-2-yl-7,8-dihydro-5H-isoquinoline-3-carboxamide |
| SMILES | CC(C)C1(C)CCc2cnc(C(=O)NC3CCC(=O)NC3=O)cc2C1 |
| InChI | InChI=1S/C19H25N3O3/c1-11(2)19(3)7-6-12-10-20-15(8-13(12)9-19)18(25)21-14-4-5-16(23)22-17(14)24/h8,10-11,14H,4-7,9H2,1-3H3,(H,21,25)(H,22,23,24) |
| InChIKey | PXPOVJDDEAXFJZ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|