C35H27F7N6O6 — CID 175621559
[2-[1-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]butyl]triazol-4-yl]-4,6-bis(trifluoromethyl)phenyl] N-(4-fluorophenyl)-N-methylcarbamate (PubChem CID 175621559) has the molecular formula C35H27F7N6O6 and a molecular weight of 760.62 g/mol. Its IUPAC name is [2-[1-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]butyl]triazol-4-yl]-4,6-bis(trifluoromethyl)phenyl] N-(4-fluorophenyl)-N-methylcarbamate.
| Compound Name | [2-[1-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]butyl]triazol-4-yl]-4,6-bis(trifluoromethyl)phenyl] N-(4-fluorophenyl)-N-methylcarbamate |
|---|---|
| PubChem CID | 175621559 |
| Molecular Formula | C35H27F7N6O6 |
| Molecular Weight | 760.62 g/mol |
| Exact Mass | 760.19 |
| IUPAC Name | [2-[1-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]butyl]triazol-4-yl]-4,6-bis(trifluoromethyl)phenyl] N-(4-fluorophenyl)-N-methylcarbamate |
| SMILES | CN(C(=O)Oc1c(-c2cn(CCCCc3cccc4c3C(=O)N(C3CCC(=O)NC3=O)C4=O)nn2)cc(C(F)(F)F)cc1C(F)(F)F)c1ccc(F)cc1 |
| InChI | InChI=1S/C35H27F7N6O6/c1-46(21-10-8-20(36)9-11-21)33(53)54-29-23(15-19(34(37,38)39)16-24(29)35(40,41)42)25-17-47(45-44-25)14-3-2-5-18-6-4-7-22-28(18)32(52)48(31(22)51)26-12-13-27(49)43-30(26)50/h4,6-11,15-17,26H,2-3,5,12-14H2,1H3,(H,43,49,50) |
| InChIKey | QYFOHRTVENPSTP-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 143.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.62 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|