About 5-(4,4-dimethyl-3-oxopentan-2-yl)oxy-2,5-dimethylhex-1-en-3-one
5-(4,4-dimethyl-3-oxopentan-2-yl)oxy-2,5-dimethylhex-1-en-3-one (PubChem CID 175622428) has the molecular formula C15H26O3
and a molecular weight of 254.37 g/mol. Its IUPAC name is 5-(4,4-dimethyl-3-oxopentan-2-yl)oxy-2,5-dimethylhex-1-en-3-one.
Molecular Properties
| Compound Name | 5-(4,4-dimethyl-3-oxopentan-2-yl)oxy-2,5-dimethylhex-1-en-3-one |
| PubChem CID | 175622428 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | 5-(4,4-dimethyl-3-oxopentan-2-yl)oxy-2,5-dimethylhex-1-en-3-one |
| SMILES | C=C(C)C(=O)CC(C)(C)OC(C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C15H26O3/c1-10(2)12(16)9-15(7,8)18-11(3)13(17)14(4,5)6/h11H,1,9H2,2-8H3 |
| InChIKey | GPLZGQXFHKTSQW-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 5-(4,4-dimethyl-3-oxopentan-2-yl)oxy-2,5-dimethylhex-1-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4,4-dimethyl-3-oxopentan-2-yl)oxy-2,5-dimethylhex-1-en-3-one?
The IUPAC name of 5-(4,4-dimethyl-3-oxopentan-2-yl)oxy-2,5-dimethylhex-1-en-3-one (CID 175622428) is 5-(4,4-dimethyl-3-oxopentan-2-yl)oxy-2,5-dimethylhex-1-en-3-one.
What is the SMILES notation for 5-(4,4-dimethyl-3-oxopentan-2-yl)oxy-2,5-dimethylhex-1-en-3-one?
The canonical SMILES for 5-(4,4-dimethyl-3-oxopentan-2-yl)oxy-2,5-dimethylhex-1-en-3-one is C=C(C)C(=O)CC(C)(C)OC(C)C(=O)C(C)(C)C.
What is the InChIKey of 5-(4,4-dimethyl-3-oxopentan-2-yl)oxy-2,5-dimethylhex-1-en-3-one?
The InChIKey is GPLZGQXFHKTSQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26O3/c1-10(2)12(16)9-15(7,8)18-11(3)13(17)14(4,5)6/h11H,1,9H2,2-8H3.
What are the key properties of 5-(4,4-dimethyl-3-oxopentan-2-yl)oxy-2,5-dimethylhex-1-en-3-one?
5-(4,4-dimethyl-3-oxopentan-2-yl)oxy-2,5-dimethylhex-1-en-3-one has a molecular weight of 254.37 g/mol, XLogP of 3.32, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4,4-dimethyl-3-oxopentan-2-yl)oxy-2,5-dimethylhex-1-en-3-one is sourced from PubChem (CID 175622428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).